Products 79199-63-6
CAS 79199-63-6 is the registry number for Argatroban Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4S)-4-methylpiperidine-2-carboxylic acid (CAS 79199-63-6) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: (2S,4S)-4-methylpiperidine-2-carboxylic acid. InChIKey: UQHCHLWYGMSPJC-WDSKDSINSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | (2S,4S)-4-methylpiperidine-2-carboxylic acid |
| InChIKey | UQHCHLWYGMSPJC-WDSKDSINSA-N |
| SMILES | C[C@H]1CCN[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S,4S)-4-Methylpiperidine-2-carboxylic acid, (2S,4S)-4-Methyl-pipecolinic acid, Argatroban Impurity 82, trans-4-Methylpiperidine-2-carboxylic acid, UQHCHLWYGMSPJC-WDSKDSINSA-, UQHCHLWYGMSPJC-WDSKDSINSA-N, (2S, 4S)-4-methyl pipecolic acid, InChI=1/C7H13NO2/c1-5-2-3-8-6(4-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/m0/s1