CAS 74903-77-8 appears in our catalog under these names: alpha,alpha'-Dibromo-p-xylene-d8, 98 atom % D, min 98% Chemical Purity, 1,4-Bis(bromomethyl)benzene-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 5 mg, 25 mg, 50 mg, 100 mg, 10 mg.
1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene (CAS 74903-77-8) is a chemical compound with the molecular formula C8H8Br2 and a molecular weight of 272.01 g/mol. IUPAC name: 1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene. InChIKey: RBZMSGOBSOCYHR-MOBLDEHESA-N.
| Molecular formula | C8H8Br2 |
|---|---|
| Molecular weight | 272.01 g/mol |
| IUPAC name | 1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene |
| InChIKey | RBZMSGOBSOCYHR-MOBLDEHESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])Br)[2H])[2H])C([2H])([2H])Br)[2H] |
Computed by PubChem (NCBI)