CAS 74950-97-3 appears in our catalog under these names: 2-Deoxy-2-chloro-D-mannose, 2-Chloro-2-deoxy-D-mannose. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 5mg, 25mg, 100mg.
(2S,3S,4R,5R)-2-chloro-3,4,5,6-tetrahydroxyhexanal (CAS 74950-97-3) is a chemical compound with the molecular formula C6H11ClO5 and a molecular weight of 198.60 g/mol. IUPAC name: (2S,3S,4R,5R)-2-chloro-3,4,5,6-tetrahydroxyhexanal. InChIKey: RBEGMPAFDRYYIG-KVTDHHQDSA-N.
| Molecular formula | C6H11ClO5 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (2S,3S,4R,5R)-2-chloro-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | RBEGMPAFDRYYIG-KVTDHHQDSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)Cl)O)O)O)O |
Computed by PubChem (NCBI)