CAS 848642-13-7 appears in our catalog under these names: Sucralose EP Impurity I, (2S,3R,4R,5R,6R)-5-Chloro-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4-triol, 95%, 4-Chloro-4-deoxy-alpha-D-galactopyranose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2S,3R,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-2,3,4-triol (CAS 848642-13-7) is a chemical compound with the molecular formula C6H11ClO5 and a molecular weight of 198.60 g/mol. IUPAC name: (2S,3R,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-2,3,4-triol. InChIKey: UDOJFSFHKNQOHC-PHYPRBDBSA-N.
| Molecular formula | C6H11ClO5 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (2S,3R,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-2,3,4-triol |
| InChIKey | UDOJFSFHKNQOHC-PHYPRBDBSA-N |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)O)O)O)Cl)O |
Computed by PubChem (NCBI)