Products 74959-65-2
CAS 74959-65-2 is the registry number for 2-((4-Chlorophenyl)methylene)-N-phenylhydrazinecarbothioamide. Offered by: TRC, Biosynth. Available pack sizes: 1g, 500mg, 1000mg.
1-[(Z)-(4-chlorophenyl)methylideneamino]-3-phenylthiourea (CAS 74959-65-2) is a chemical compound with the molecular formula C14H12ClN3S and a molecular weight of 289.8 g/mol. IUPAC name: 1-[(Z)-(4-chlorophenyl)methylideneamino]-3-phenylthiourea. InChIKey: XRVFOPFFNVHUJE-YBEGLDIGSA-N.
| Molecular formula | C14H12ClN3S |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 1-[(Z)-(4-chlorophenyl)methylideneamino]-3-phenylthiourea |
| InChIKey | XRVFOPFFNVHUJE-YBEGLDIGSA-N |
| SMILES | C1=CC=C(C=C1)NC(=S)N/N=C\C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)