CAS 103312-62-5 appears in our catalog under these names: Rabeprazole Impurity 4, Rabeprazole sodium Impurity I,Lansoprazole EP Impurity F Sulfide, 2-(((4-Chloro-3-methylpyridin-2-yl)methyl)thio)-1H-benzo(d)imidazole, 95-<97%, 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfide, 2-((4-Chloro-3-methyl-2-pyridinyl)methylthio)-1H-benzimidazole. Offered by: Chemat Brand, Hoffman Fine Chemicals, TRC, Biosynth. Available pack sizes: on request, 250mg, 500mg, 1g, 2,5g, 5g, 10g, 10mg.
2-[(4-chloro-3-methyl-2-pyridinyl)methylsulfanyl]-1H-benzimidazole (CAS 103312-62-5) is a chemical compound with the molecular formula C14H12ClN3S and a molecular weight of 289.8 g/mol. IUPAC name: 2-[(4-chloro-3-methyl-2-pyridinyl)methylsulfanyl]-1H-benzimidazole. InChIKey: NKBICFMRRCFCFT-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3S |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 2-[(4-chloro-3-methyl-2-pyridinyl)methylsulfanyl]-1H-benzimidazole |
| InChIKey | NKBICFMRRCFCFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CSC2=NC3=CC=CC=C3N2)Cl |
Computed by PubChem (NCBI)