CAS 941867-42-1 is the registry number for 7-Chloro-4-methyl-n-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
7-chloro-4-methyl-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine (CAS 941867-42-1) is a chemical compound with the molecular formula C14H12ClN3S and a molecular weight of 289.8 g/mol. IUPAC name: 7-chloro-4-methyl-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine. InChIKey: RYENHHAMSPORRT-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3S |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 7-chloro-4-methyl-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine |
| InChIKey | RYENHHAMSPORRT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)SC(=N2)NCC3=CN=CC=C3 |
Computed by PubChem (NCBI)