Products 74965-31-4
CAS 74965-31-4 appears in our catalog under these names: O-Tolyl-carbamic acid tert-butyl ester, 95%, tert-Butyl o-tolylcarbamate, 95%, Tert-butyl o-tolylcarbamate, 97%, 97%, Tert-butyl o-tolylcarbamate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 250mg.
Tert-butyl N-(2-methylphenyl)carbamate (CAS 74965-31-4) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl N-(2-methylphenyl)carbamate. InChIKey: UMDAFUNCFQYMDP-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl N-(2-methylphenyl)carbamate |
| InChIKey | UMDAFUNCFQYMDP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)