CAS 749869-98-5 appears in our catalog under these names: 1H-Indene-2-boronic acid pinacol ester, 2-(1H-Inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 2-(1H-Inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(1H-Inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
2-(1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 749869-98-5) is a chemical compound with the molecular formula C15H19BO2 and a molecular weight of 242.12 g/mol. IUPAC name: 2-(1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GHLNFPJNICWOHP-UHFFFAOYSA-N.
| Molecular formula | C15H19BO2 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2-(1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GHLNFPJNICWOHP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3C2 |
Computed by PubChem (NCBI)