CAS 872356-93-9 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(p-tolylethynyl)-1,3,2-dioxaborolane, 95-<97%, 4,4,5,5-Tetramethyl-2-(p-tolylethynyl)-1,3,2-dioxaborolane, 98%. Offered by: Hoffman Fine Chemicals, Chemat Brand. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, on request.
4,4,5,5-tetramethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-dioxaborolane (CAS 872356-93-9) is a chemical compound with the molecular formula C15H19BO2 and a molecular weight of 242.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-dioxaborolane. InChIKey: WNRPHCREBAZCGZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BO2 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-dioxaborolane |
| InChIKey | WNRPHCREBAZCGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)