Products 7501-37-3

CAS 7501-37-3 is the registry number for 4-(4-Isopropylphenyl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(4-propan-2-ylphenyl)butanoic acid (CAS 7501-37-3) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 4-(4-propan-2-ylphenyl)butanoic acid. InChIKey: COMUZXZDTNYSJE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O2
Molecular weight206.28 g/mol
IUPAC name4-(4-propan-2-ylphenyl)butanoic acid
InChIKeyCOMUZXZDTNYSJE-UHFFFAOYSA-N
SMILESCC(C)C1=CC=C(C=C1)CCCC(=O)O

Computed by PubChem (NCBI)