Products 750608-18-5
CAS 750608-18-5 appears in our catalog under these names: 2-Chloro-n-(2-[(2,6-dimethylphenyl)amino]-2-oxoethyl)propanamide, 95%, 2-Chloro-N-{((2,6-dimethylphenyl)carbamoyl)methyl}propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide (CAS 750608-18-5) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: 2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide. InChIKey: ODVCCMHXEFKDBY-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | 2-chloro-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide |
| InChIKey | ODVCCMHXEFKDBY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CNC(=O)C(C)Cl |
Computed by PubChem (NCBI)