CAS 75100-65-1 is the registry number for Methyl 2,4,4-trimethyl-6-oxocyclohex-1-ene-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,4,4-trimethyl-6-oxocyclohexene-1-carboxylate (CAS 75100-65-1) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: methyl 2,4,4-trimethyl-6-oxocyclohexene-1-carboxylate. InChIKey: NRQHBEIJFHZERL-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | methyl 2,4,4-trimethyl-6-oxocyclohexene-1-carboxylate |
| InChIKey | NRQHBEIJFHZERL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)CC(C1)(C)C)C(=O)OC |
Computed by PubChem (NCBI)