CAS 752132-49-3 is the registry number for 2-Bromo-4-(trifluoromethoxy)benzene-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 10g.
2-bromo-4-(trifluoromethoxy)benzenesulfonyl chloride (CAS 752132-49-3) is a chemical compound with the molecular formula C7H3BrClF3O3S and a molecular weight of 339.51 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: VWWRUCDVDGRSNG-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O3S |
|---|---|
| Molecular weight | 339.51 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzenesulfonyl chloride |
| InChIKey | VWWRUCDVDGRSNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)