Products 915763-79-0

CAS 915763-79-0 appears in our catalog under these names: 5-Bromo-2-(trifluoromethoxy)benzene-1-sulfonyl chloride, 95%, 95%, 5-BROMO-2-(TRIFLUOROMETHOXY)BENZENE-1-SULFONYL CHLORIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-bromo-2-(trifluoromethoxy)benzenesulfonyl chloride (CAS 915763-79-0) is a chemical compound with the molecular formula C7H3BrClF3O3S and a molecular weight of 339.51 g/mol. IUPAC name: 5-bromo-2-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: XZAKKJIPMFOOPN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClF3O3S
Molecular weight339.51 g/mol
IUPAC name5-bromo-2-(trifluoromethoxy)benzenesulfonyl chloride
InChIKeyXZAKKJIPMFOOPN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)S(=O)(=O)Cl)OC(F)(F)F

Computed by PubChem (NCBI)