CAS 752181-59-2 is the registry number for Ethyl (1S,2S)–2–Aminocyclopentanecarboxylate. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Trans-ethyl (1S,2S)-2-aminocyclopentane-1-carboxylate (CAS 752181-59-2) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-aminocyclopentane-1-carboxylate. InChIKey: AGCJYTRMZBPEEO-BQBZGAKWSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-aminocyclopentane-1-carboxylate |
| InChIKey | AGCJYTRMZBPEEO-BQBZGAKWSA-N |
| SMILES | CCOC(=O)[C@H]1CCC[C@@H]1N |
Computed by PubChem (NCBI)