CAS 75238-29-8 appears in our catalog under these names: Methyl 3,5-dihydroxy-4-methylbenzoate, 95%, Methyl3,5-dihydroxy-4-methylbenzoate, 95%, 3,5-Dihydroxy-4-methylbenzoic acid methyl ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 50g, 25g, 10g, 5g.
Methyl 3,5-dihydroxy-4-methylbenzoate (CAS 75238-29-8) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: methyl 3,5-dihydroxy-4-methylbenzoate. InChIKey: YVVWRFQRKJIERW-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | methyl 3,5-dihydroxy-4-methylbenzoate |
| InChIKey | YVVWRFQRKJIERW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1O)C(=O)OC)O |
Computed by PubChem (NCBI)