Products 75238-45-8
CAS 75238-45-8 appears in our catalog under these names: Tryptophol-d4, >95% (HPLC), Tryptophol-d4, 99.97%. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 2,5mg, 50mg, 2.5 mg.
1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)ethanol (CAS 75238-45-8) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 165.22 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)ethanol. InChIKey: MBBOMCVGYCRMEA-NZLXMSDQSA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 165.22 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)ethanol |
| InChIKey | MBBOMCVGYCRMEA-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=CC=CC=C21)C([2H])([2H])O |
Computed by PubChem (NCBI)