Products 75238-47-0
CAS 75238-47-0 appears in our catalog under these names: 5-(Phenylmethoxy)-1H-indole-3-ethan-Alpha,Alpha,Beta,Beta-d4-ol, 5-Benzyloxytryptophol-alpha,alpha,beta,beta-d4, 99 atom % D, min 98% Chemical Purity, 5-Methoxytryptophol-benzene-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 0,05g, 0,01g, 2.5 mg, 10 mg, 5 mg.
1,1,2,2-tetradeuterio-2-(5-phenylmethoxy-1H-indol-3-yl)ethanol (CAS 75238-47-0) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 271.35 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(5-phenylmethoxy-1H-indol-3-yl)ethanol. InChIKey: SQAUQUOZCKVQND-LZMSFWOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(5-phenylmethoxy-1H-indol-3-yl)ethanol |
| InChIKey | SQAUQUOZCKVQND-LZMSFWOYSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)OCC3=CC=CC=C3)C([2H])([2H])O |
Computed by PubChem (NCBI)