Products 7529-87-5

CAS 7529-87-5 appears in our catalog under these names: Monoisopropyl fumarate, 95%, Monoisopropyl Fumarate, Monoisopropyl Fumarate, >97.0%(GC)(T), (E)-4-Isopropoxy-4-oxobut-2-enoic acid 97%, 2-Butenedioic acid (2E)-, 1-(1-methylethyl) ester, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

(E)-4-oxo-4-propan-2-yloxybut-2-enoic acid (CAS 7529-87-5) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: (E)-4-oxo-4-propan-2-yloxybut-2-enoic acid. InChIKey: FWUIHQFQLSWYED-ONEGZZNKSA-N.

Identity
Molecular formulaC7H10O4
Molecular weight158.15 g/mol
IUPAC name(E)-4-oxo-4-propan-2-yloxybut-2-enoic acid
InChIKeyFWUIHQFQLSWYED-ONEGZZNKSA-N
SMILESCC(C)OC(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)