CAS 75328-54-0 is the registry number for Dimethyl bicyclo(3.1.1)heptane-1,5-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dimethyl bicyclo[3.1.1]heptane-1,5-dicarboxylate (CAS 75328-54-0) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: dimethyl bicyclo[3.1.1]heptane-1,5-dicarboxylate. InChIKey: XBJPZUHSXVMNEU-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | dimethyl bicyclo[3.1.1]heptane-1,5-dicarboxylate |
| InChIKey | XBJPZUHSXVMNEU-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCCC(C1)(C2)C(=O)OC |
Computed by PubChem (NCBI)