CAS 753480-67-0 is the registry number for tert-Butyl 2-cyanoindoline-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 2-cyano-2,3-dihydroindole-1-carboxylate (CAS 753480-67-0) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: tert-butyl 2-cyano-2,3-dihydroindole-1-carboxylate. InChIKey: YFUICMOSRQSXTO-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | tert-butyl 2-cyano-2,3-dihydroindole-1-carboxylate |
| InChIKey | YFUICMOSRQSXTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(CC2=CC=CC=C21)C#N |
Computed by PubChem (NCBI)