CAS 75487-97-7 is the registry number for 8-Amino-2H-chromen-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-aminochromen-2-one (CAS 75487-97-7) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 8-aminochromen-2-one. InChIKey: HEOPSOVUMHIMOD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 8-aminochromen-2-one |
| InChIKey | HEOPSOVUMHIMOD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)OC(=O)C=C2 |
Computed by PubChem (NCBI)