Products 75607-68-0
CAS 75607-68-0 is the registry number for D-Mannitol-d1. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2R,3R,4R,5R)-2-deuteriohexane-1,2,3,4,5,6-hexol (CAS 75607-68-0) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 183.18 g/mol. IUPAC name: (2R,3R,4R,5R)-2-deuteriohexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-JNHZOBAGSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-deuteriohexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-JNHZOBAGSA-N |
| SMILES | [2H][C@@](CO)([C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)