CAS 756478-86-1 appears in our catalog under these names: 4-(2-Phenylethoxy)benzoyl chloride, 95%, 4-Phenethoxybenzoyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(2-phenylethoxy)benzoyl chloride (CAS 756478-86-1) is a chemical compound with the molecular formula C15H13ClO2 and a molecular weight of 260.71 g/mol. IUPAC name: 4-(2-phenylethoxy)benzoyl chloride. InChIKey: KLLLZNAMDISNRS-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO2 |
|---|---|
| Molecular weight | 260.71 g/mol |
| IUPAC name | 4-(2-phenylethoxy)benzoyl chloride |
| InChIKey | KLLLZNAMDISNRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCOC2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)