CAS 756500-12-6 is the registry number for tert-Butyl 2-amino-3-methylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-amino-3-methylbenzoate (CAS 756500-12-6) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 2-amino-3-methylbenzoate. InChIKey: YEWWZQZDWUQMMI-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 2-amino-3-methylbenzoate |
| InChIKey | YEWWZQZDWUQMMI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)