CAS 75667-94-6 appears in our catalog under these names: 2-(3-Aminoadamantan-1-yl)acetic acid hydrochloride, 95%, 2–(3–Aminoadamantan–1–yl)acetic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 5mg.
2-(3-amino-1-adamantyl)acetic acid;hydrochloride (CAS 75667-94-6) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: 2-(3-amino-1-adamantyl)acetic acid;hydrochloride. InChIKey: DXXZWAMIRWFYBO-UHFFFAOYSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | 2-(3-amino-1-adamantyl)acetic acid;hydrochloride |
| InChIKey | DXXZWAMIRWFYBO-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N)CC(=O)O.Cl |
Computed by PubChem (NCBI)