Products 80110-35-6

CAS 80110-35-6 is the registry number for Methyl 3-aminoadamantane-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-aminoadamantane-1-carboxylate;hydrochloride (CAS 80110-35-6) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: methyl 3-aminoadamantane-1-carboxylate;hydrochloride. InChIKey: GMXYKQPNBFHSEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20ClNO2
Molecular weight245.74 g/mol
IUPAC namemethyl 3-aminoadamantane-1-carboxylate;hydrochloride
InChIKeyGMXYKQPNBFHSEJ-UHFFFAOYSA-N
SMILESCOC(=O)C12CC3CC(C1)CC(C3)(C2)N.Cl

Computed by PubChem (NCBI)