CAS 80110-35-6 is the registry number for Methyl 3-aminoadamantane-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
Methyl 3-aminoadamantane-1-carboxylate;hydrochloride (CAS 80110-35-6) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: methyl 3-aminoadamantane-1-carboxylate;hydrochloride. InChIKey: GMXYKQPNBFHSEJ-UHFFFAOYSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | methyl 3-aminoadamantane-1-carboxylate;hydrochloride |
| InChIKey | GMXYKQPNBFHSEJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)CC(C3)(C2)N.Cl |
Computed by PubChem (NCBI)