CAS 75695-99-7 appears in our catalog under these names: Isradipine EP Impurity A, 3-Ethyl 5-methyl 4-(benzo[c][1,2,5]oxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, 95%, Isradipine Impurity 1(Isradipine EP Impurity A). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-O-ethyl 3-O-methyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 75695-99-7) is a chemical compound with the molecular formula C18H19N3O5 and a molecular weight of 357.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: JZLLWZJRQZWSRQ-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | JZLLWZJRQZWSRQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC3=NON=C32)C(=O)OC)C)C |
Computed by PubChem (NCBI)