CAS 88977-30-4 is the registry number for Demethyl Isradipine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-3-carboxylic acid (CAS 88977-30-4) is a chemical compound with the molecular formula C18H19N3O5 and a molecular weight of 357.4 g/mol. IUPAC name: 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-3-carboxylic acid. InChIKey: JNLUMMRKXUTNAA-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-3-carboxylic acid |
| InChIKey | JNLUMMRKXUTNAA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC=CC3=NON=C32)C(=O)O |
Computed by PubChem (NCBI)