CAS 757192-85-1 is the registry number for 2-Chloro-1-[1-(3,5-dichlorophenyl)-2,5-dimethyl-1h-pyrrol-3-yl]ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 10g, 5g.
2-chloro-1-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (CAS 757192-85-1) is a chemical compound with the molecular formula C14H12Cl3NO and a molecular weight of 316.6 g/mol. IUPAC name: 2-chloro-1-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone. InChIKey: YSFLRNRMGBTNSJ-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl3NO |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | 2-chloro-1-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| InChIKey | YSFLRNRMGBTNSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC(=CC(=C2)Cl)Cl)C)C(=O)CCl |
Computed by PubChem (NCBI)