CAS 885268-72-4 is the registry number for 2-Chloro-1-(1-(2,5-dichlorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl)ethanone, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-chloro-1-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (CAS 885268-72-4) is a chemical compound with the molecular formula C14H12Cl3NO and a molecular weight of 316.6 g/mol. IUPAC name: 2-chloro-1-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone. InChIKey: GRSAFVIUVJUDLJ-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl3NO |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | 2-chloro-1-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| InChIKey | GRSAFVIUVJUDLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C=CC(=C2)Cl)Cl)C)C(=O)CCl |
Computed by PubChem (NCBI)