CAS 7576-88-7 is the registry number for 2,3-Dimethyl-6-quinoxalinamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dimethylquinoxalin-6-amine (CAS 7576-88-7) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 2,3-dimethylquinoxalin-6-amine. InChIKey: QBZGAULXCVZXFL-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,3-dimethylquinoxalin-6-amine |
| InChIKey | QBZGAULXCVZXFL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=C(C=CC2=N1)N)C |
Computed by PubChem (NCBI)