CAS 7579-70-6 is the registry number for Diphenyl(m-tolyl)phosphine, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(3-methylphenyl)-diphenylphosphane (CAS 7579-70-6) is a chemical compound with the molecular formula C19H17P and a molecular weight of 276.3 g/mol. IUPAC name: (3-methylphenyl)-diphenylphosphane. InChIKey: BGUPWTFDMHDYIR-UHFFFAOYSA-N.
| Molecular formula | C19H17P |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | (3-methylphenyl)-diphenylphosphane |
| InChIKey | BGUPWTFDMHDYIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)