CAS 7650-91-1 appears in our catalog under these names: BENZYLDIPHENYLPHOSPHINE, >=95%, Benzyldiphenylphosphine, ≥85%, ≥85%, Benzyldiphenylphosphine, ≥85%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5G, 1g, 25g.
Benzyl(diphenyl)phosphane (CAS 7650-91-1) is a chemical compound with the molecular formula C19H17P and a molecular weight of 276.3 g/mol. IUPAC name: benzyl(diphenyl)phosphane. InChIKey: UZCPNEBHTFYJNY-UHFFFAOYSA-N.
| Molecular formula | C19H17P |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | benzyl(diphenyl)phosphane |
| InChIKey | UZCPNEBHTFYJNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CP(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)