CAS 759443-00-0 appears in our catalog under these names: (2E,2'E)-Upenazime/ 99.37% (existing batch purity), (2E,2'E)-Upenazime. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(NE)-N-[3-[4-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine (CAS 759443-00-0) is a chemical compound with the molecular formula C14H30N4O2 and a molecular weight of 286.41 g/mol. IUPAC name: (NE)-N-[3-[4-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine. InChIKey: HOZDZMALDHKOFZ-JYFOCSDGSA-N.
| Molecular formula | C14H30N4O2 |
|---|---|
| Molecular weight | 286.41 g/mol |
| IUPAC name | (NE)-N-[3-[4-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine |
| InChIKey | HOZDZMALDHKOFZ-JYFOCSDGSA-N |
| SMILES | C/C(=N\O)/C(NCCCCNC(/C(=N/O)/C)(C)C)(C)C |
Computed by PubChem (NCBI)