CAS 76092-29-0 is the registry number for 1-Bromo-4-(tribromomethyl)benzene. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-bromo-4-(tribromomethyl)benzene (CAS 76092-29-0) is a chemical compound with the molecular formula C7H4Br4 and a molecular weight of 407.72 g/mol. IUPAC name: 1-bromo-4-(tribromomethyl)benzene. InChIKey: JYAVJLTUVOJMPZ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br4 |
|---|---|
| Molecular weight | 407.72 g/mol |
| IUPAC name | 1-bromo-4-(tribromomethyl)benzene |
| InChIKey | JYAVJLTUVOJMPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(Br)(Br)Br)Br |
Computed by PubChem (NCBI)