CAS 76105-83-4 is the registry number for 1-(Pyridin-2-yl)-1H-1,2,3,4-tetrazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-pyridin-2-yltetrazol-5-amine (CAS 76105-83-4) is a chemical compound with the molecular formula C6H6N6 and a molecular weight of 162.15 g/mol. IUPAC name: 1-pyridin-2-yltetrazol-5-amine. InChIKey: FADGFMYUPVUGEU-UHFFFAOYSA-N.
| Molecular formula | C6H6N6 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1-pyridin-2-yltetrazol-5-amine |
| InChIKey | FADGFMYUPVUGEU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N2C(=NN=N2)N |
Computed by PubChem (NCBI)