Products 76118-05-3

CAS 76118-05-3 appears in our catalog under these names: 2-Ethylbenzoyl chloride, 95%, 2-Ethylbenzoyl chloride, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-ethylbenzoyl chloride (CAS 76118-05-3) is a chemical compound with the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. IUPAC name: 2-ethylbenzoyl chloride. InChIKey: PJGFNNXYKMSCCU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO
Molecular weight168.62 g/mol
IUPAC name2-ethylbenzoyl chloride
InChIKeyPJGFNNXYKMSCCU-UHFFFAOYSA-N
SMILESCCC1=CC=CC=C1C(=O)Cl

Computed by PubChem (NCBI)