Products 761440-57-7
CAS 761440-57-7 is the registry number for (1-(3-Methoxy-4-nitrophenyl)piperidin-4-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]methanol (CAS 761440-57-7) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: [1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]methanol. InChIKey: LHOUEXISFKGKEG-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | [1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]methanol |
| InChIKey | LHOUEXISFKGKEG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCC(CC2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)