Products 76265-38-8
CAS 76265-38-8 is the registry number for γ-Chloronorvaline. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,4S)-2-amino-4-chloropentanoic acid (CAS 76265-38-8) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. IUPAC name: (2S,4S)-2-amino-4-chloropentanoic acid. InChIKey: RGNIDFUXHFKULB-IMJSIDKUSA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | (2S,4S)-2-amino-4-chloropentanoic acid |
| InChIKey | RGNIDFUXHFKULB-IMJSIDKUSA-N |
| SMILES | C[C@@H](C[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)