Products 76311-49-4
CAS 76311-49-4 is the registry number for 3,4-Dihydro-2H-spiro(naphthalene-1,2'-(1,4)oxazolidine)-3',5'-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Spiro[1,3-oxazolidine-5,4'-2,3-dihydro-1H-naphthalene]-2,4-dione (CAS 76311-49-4) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: spiro[1,3-oxazolidine-5,4'-2,3-dihydro-1H-naphthalene]-2,4-dione. InChIKey: SOKLCOPCKATUMT-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | spiro[1,3-oxazolidine-5,4'-2,3-dihydro-1H-naphthalene]-2,4-dione |
| InChIKey | SOKLCOPCKATUMT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C3(C1)C(=O)NC(=O)O3 |
Computed by PubChem (NCBI)