CAS 763114-26-7 appears in our catalog under these names: Olaparib Impurity 33, Olaparib Impurity 20, 2-Fluoro-5-(4-oxo-3,4-dihydrophthalazin-1-ylmethyl)benzoic Acid, >95% (HPLC), 2-fluoro-5-((4-oxo-3h-phthalazin-1-yl)methyl)benzoic Acid, 2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic acid 98%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 250mg, 500g, 1g, 5g, 10g, 25g, 100g.
2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 763114-26-7) is a chemical compound with the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. IUPAC name: 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: PAXLJNGPFJEKQX-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O3 |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid |
| InChIKey | PAXLJNGPFJEKQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)