CAS 953730-51-3 is the registry number for 3-Cyclopropyl-6-(4-fluorophenyl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-cyclopropyl-6-(4-fluorophenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 953730-51-3) is a chemical compound with the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. IUPAC name: 3-cyclopropyl-6-(4-fluorophenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: SKYTVXWEFWNEHT-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O3 |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | 3-cyclopropyl-6-(4-fluorophenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | SKYTVXWEFWNEHT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC3=C2C(=CC(=N3)C4=CC=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)