CAS 76391-33-8 is the registry number for Enalaprilat Benzyl Ester. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 100mg, 50mg.
(2S)-1-[(2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 76391-33-8) is a chemical compound with the molecular formula C25H30N2O5 and a molecular weight of 438.5 g/mol. IUPAC name: (2S)-1-[(2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: XETMTRRGHPOVSP-NYVOZVTQSA-N.
| Molecular formula | C25H30N2O5 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[[(2S)-1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | XETMTRRGHPOVSP-NYVOZVTQSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N[C@@H](CCC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)