CAS 76578-71-7 is the registry number for (R)-Quizalofop Methyl. Offered by: TRC. Available pack sizes: 250mg.
Methyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate (CAS 76578-71-7) is a chemical compound with the molecular formula C18H15ClN2O4 and a molecular weight of 358.8 g/mol. IUPAC name: methyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate. InChIKey: YGHJGQYNECSZDY-LLVKDONJSA-N.
| Molecular formula | C18H15ClN2O4 |
|---|---|
| Molecular weight | 358.8 g/mol |
| IUPAC name | methyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
| InChIKey | YGHJGQYNECSZDY-LLVKDONJSA-N |
| SMILES | C[C@H](C(=O)OC)OC1=CC=C(C=C1)OC2=CN=C3C=C(C=CC3=N2)Cl |
Computed by PubChem (NCBI)