Products 765861-94-7
CAS 765861-94-7 is the registry number for 5-Amino-5,6,7,8-tetrahydronaphthalen-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-amino-5,6,7,8-tetrahydronaphthalen-2-ol (CAS 765861-94-7) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: 5-amino-5,6,7,8-tetrahydronaphthalen-2-ol. InChIKey: OGCNDVHUWVSJRM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | 5-amino-5,6,7,8-tetrahydronaphthalen-2-ol |
| InChIKey | OGCNDVHUWVSJRM-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)O)N |
Computed by PubChem (NCBI)