Products 765890-91-3
CAS 765890-91-3 is the registry number for Nitromemantine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3-amino-5,7-diethyl-1-adamantyl) nitrate (CAS 765890-91-3) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: (3-amino-5,7-diethyl-1-adamantyl) nitrate. InChIKey: SENUTBBWBZZNRT-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | (3-amino-5,7-diethyl-1-adamantyl) nitrate |
| InChIKey | SENUTBBWBZZNRT-UHFFFAOYSA-N |
| SMILES | CCC12CC3(CC(C1)(CC(C2)(C3)O[N+](=O)[O-])N)CC |
Computed by PubChem (NCBI)