Products 765891-92-7

CAS 765891-92-7 is the registry number for 3-(4-Methylpiperidin-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

3-(4-methylpiperidin-1-yl)propanoic acid;hydrochloride (CAS 765891-92-7) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: 3-(4-methylpiperidin-1-yl)propanoic acid;hydrochloride. InChIKey: POZODKNKLOJGEK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC name3-(4-methylpiperidin-1-yl)propanoic acid;hydrochloride
InChIKeyPOZODKNKLOJGEK-UHFFFAOYSA-N
SMILESCC1CCN(CC1)CCC(=O)O.Cl

Computed by PubChem (NCBI)