Products 765949-21-1
CAS 765949-21-1 is the registry number for Tyrosine kinase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(7-methoxy-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea (CAS 765949-21-1) is a chemical compound with the molecular formula C23H21N3O3 and a molecular weight of 387.4 g/mol. IUPAC name: 1-[4-(7-methoxy-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea. InChIKey: XZXIHTJGNYBSTH-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O3 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 1-[4-(7-methoxy-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-(3-methylphenyl)urea |
| InChIKey | XZXIHTJGNYBSTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)C3=C4CNC(=O)C4=C(C=C3)OC |
Computed by PubChem (NCBI)
Synonyms:
Tyrosine kinase-IN-4, orb1688306